C20H18N4O5S2 — CID 170987849
6,7-dimethoxy-3-(4-methoxyphenyl)-2-[(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)methylsulfanyl]quinazolin-4-one (PubChem CID 170987849) has the molecular formula C20H18N4O5S2 and a molecular weight of 458.52 g/mol. Its IUPAC name is 6,7-dimethoxy-3-(4-methoxyphenyl)-2-[(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 6,7-dimethoxy-3-(4-methoxyphenyl)-2-[(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 170987849 |
| Molecular Formula | C20H18N4O5S2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 6,7-dimethoxy-3-(4-methoxyphenyl)-2-[(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)methylsulfanyl]quinazolin-4-one |
| SMILES | COc1ccc(-n2c(SCc3n[nH]c(=S)o3)nc3cc(OC)c(OC)cc3c2=O)cc1 |
| InChI | InChI=1S/C20H18N4O5S2/c1-26-12-6-4-11(5-7-12)24-18(25)13-8-15(27-2)16(28-3)9-14(13)21-19(24)31-10-17-22-23-20(30)29-17/h4-9H,10H2,1-3H3,(H,23,30) |
| InChIKey | PGPGRJHPPWTWCD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|