C15H18O2 — CID 170988116
methyl 1,4,4,5,6-pentadeuterio-6-methyl-5-phenylcyclohex-2-ene-1-carboxylate (PubChem CID 170988116) has the molecular formula C15H18O2 and a molecular weight of 235.34 g/mol. Its IUPAC name is methyl 1,4,4,5,6-pentadeuterio-6-methyl-5-phenylcyclohex-2-ene-1-carboxylate.
| Compound Name | methyl 1,4,4,5,6-pentadeuterio-6-methyl-5-phenylcyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 170988116 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 235.34 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | methyl 1,4,4,5,6-pentadeuterio-6-methyl-5-phenylcyclohex-2-ene-1-carboxylate |
| SMILES | [2H]C1([2H])C=CC([2H])(C(=O)OC)C([2H])(C)C1([2H])c1ccccc1 |
| InChI | InChI=1S/C15H18O2/c1-11-13(12-7-4-3-5-8-12)9-6-10-14(11)15(16)17-2/h3-8,10-11,13-14H,9H2,1-2H3/i9D2,11D,13D,14D |
| InChIKey | HZOSAGABBBQBDX-SCFOYAGASA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|