C29H41NO6 — CID 170988216
(1R,2E,4S,5R,6R,7S,9R,10Z,16S,17R,18S,19R,21S,24S)-5,6,7,9,19-pentahydroxy-4,14,16,21-tetramethyl-22-azatetracyclo[14.10.0.017,24.018,22]hexacosa-2,10,12,14,25-pentaen-23-one (PubChem CID 170988216) has the molecular formula C29H41NO6 and a molecular weight of 499.65 g/mol. Its IUPAC name is (1R,2E,4S,5R,6R,7S,9R,10Z,16S,17R,18S,19R,21S,24S)-5,6,7,9,19-pentahydroxy-4,14,16,21-tetramethyl-22-azatetracyclo[14.10.0.017,24.018,22]hexacosa-2,10,12,14,25-pentaen-23-one.
| Compound Name | (1R,2E,4S,5R,6R,7S,9R,10Z,16S,17R,18S,19R,21S,24S)-5,6,7,9,19-pentahydroxy-4,14,16,21-tetramethyl-22-azatetracyclo[14.10.0.017,24.018,22]hexacosa-2,10,12,14,25-pentaen-23-one |
|---|---|
| PubChem CID | 170988216 |
| Molecular Formula | C29H41NO6 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | (1R,2E,4S,5R,6R,7S,9R,10Z,16S,17R,18S,19R,21S,24S)-5,6,7,9,19-pentahydroxy-4,14,16,21-tetramethyl-22-azatetracyclo[14.10.0.017,24.018,22]hexacosa-2,10,12,14,25-pentaen-23-one |
| SMILES | CC1=C[C@@]2(C)[C@@H]3[C@H]4[C@H](O)C[C@H](C)N4C(=O)[C@H]3C=C[C@H]2/C=C/[C@H](C)[C@@H](O)[C@H](O)[C@@H](O)C[C@@H](O)/C=C\C=C1 |
| InChI | InChI=1S/C29H41NO6/c1-16-7-5-6-8-20(31)14-23(33)27(35)26(34)17(2)9-10-19-11-12-21-24(29(19,4)15-16)25-22(32)13-18(3)30(25)28(21)36/h5-12,15,17-27,31-35H,13-14H2,1-4H3/b7-5?,8-6-,10-9+,16-15?/t17-,18-,19+,20-,21-,22+,23-,24-,25+,26+,27+,29+/m0/s1 |
| InChIKey | QNMVPLAOMNKLPD-ISGWEMSPSA-N |
| XLogP | 1.87 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|