C34H52O5 — CID 170988265
1-O-methyl 3-O-[(2R)-6-methyl-2-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]hept-5-enyl] propanedioate (PubChem CID 170988265) has the molecular formula C34H52O5 and a molecular weight of 540.79 g/mol. Its IUPAC name is 1-O-methyl 3-O-[(2R)-6-methyl-2-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]hept-5-enyl] propanedioate.
| Compound Name | 1-O-methyl 3-O-[(2R)-6-methyl-2-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]hept-5-enyl] propanedioate |
|---|---|
| PubChem CID | 170988265 |
| Molecular Formula | C34H52O5 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.38 |
| IUPAC Name | 1-O-methyl 3-O-[(2R)-6-methyl-2-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]hept-5-enyl] propanedioate |
| SMILES | COC(=O)CC(=O)OC[C@H](CCC=C(C)C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C34H52O5/c1-22(2)10-9-11-23(21-39-30(37)20-29(36)38-8)24-14-18-34(7)26-12-13-27-31(3,4)28(35)16-17-32(27,5)25(26)15-19-33(24,34)6/h10,23-24,27H,9,11-21H2,1-8H3/t23-,24+,27-,32+,33+,34-/m0/s1 |
| InChIKey | BKLOITNSHQSVKL-GHDLVDSASA-N |
| XLogP | 7.77 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|