C19H22O3 — CID 170988314
1-[(1R,2S,3S)-1,2-dihydroxy-3,6,7-trimethyl-3,4-dihydro-1H-anthracen-2-yl]ethanone (PubChem CID 170988314) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 1-[(1R,2S,3S)-1,2-dihydroxy-3,6,7-trimethyl-3,4-dihydro-1H-anthracen-2-yl]ethanone.
| Compound Name | 1-[(1R,2S,3S)-1,2-dihydroxy-3,6,7-trimethyl-3,4-dihydro-1H-anthracen-2-yl]ethanone |
|---|---|
| PubChem CID | 170988314 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 1-[(1R,2S,3S)-1,2-dihydroxy-3,6,7-trimethyl-3,4-dihydro-1H-anthracen-2-yl]ethanone |
| SMILES | CC(=O)[C@@]1(O)[C@H](O)c2cc3cc(C)c(C)cc3cc2C[C@@H]1C |
| InChI | InChI=1S/C19H22O3/c1-10-5-14-8-16-7-12(3)19(22,13(4)20)18(21)17(16)9-15(14)6-11(10)2/h5-6,8-9,12,18,21-22H,7H2,1-4H3/t12-,18+,19+/m0/s1 |
| InChIKey | AOFDSZQJMGWHJE-GESALYCCSA-N |
| XLogP | 3.00 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |