C11H16O3 — CID 170988339
(3E,5Z,7E,9S)-9-hydroxy-6-(hydroxymethyl)deca-3,5,7-trien-2-one (PubChem CID 170988339) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (3E,5Z,7E,9S)-9-hydroxy-6-(hydroxymethyl)deca-3,5,7-trien-2-one.
| Compound Name | (3E,5Z,7E,9S)-9-hydroxy-6-(hydroxymethyl)deca-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 170988339 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (3E,5Z,7E,9S)-9-hydroxy-6-(hydroxymethyl)deca-3,5,7-trien-2-one |
| SMILES | CC(=O)/C=C/C=C(/C=C/[C@H](C)O)CO |
| InChI | InChI=1S/C11H16O3/c1-9(13)4-3-5-11(8-12)7-6-10(2)14/h3-7,10,12,14H,8H2,1-2H3/b4-3+,7-6+,11-5-/t10-/m0/s1 |
| InChIKey | WCBFORQQMPZPEQ-AOBYYGGNSA-N |
| XLogP | 0.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|