About (3E,7R)-7-hydroxy-2-[(2S)-2-hydroxypropylidene]octa-3,5-dienal
(3E,7R)-7-hydroxy-2-[(2S)-2-hydroxypropylidene]octa-3,5-dienal (PubChem CID 170988344) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is (3E,7R)-7-hydroxy-2-[(2S)-2-hydroxypropylidene]octa-3,5-dienal.
Molecular Properties
| Compound Name | (3E,7R)-7-hydroxy-2-[(2S)-2-hydroxypropylidene]octa-3,5-dienal |
| PubChem CID | 170988344 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (3E,7R)-7-hydroxy-2-[(2S)-2-hydroxypropylidene]octa-3,5-dienal |
| SMILES | C[C@H](O)C=C(C=O)/C=C/C=C[C@@H](C)O |
| InChI | InChI=1S/C11H16O3/c1-9(13)5-3-4-6-11(8-12)7-10(2)14/h3-10,13-14H,1-2H3/b5-3?,6-4+,11-7?/t9-,10+/m1/s1 |
| InChIKey | AACXHGSVRHGLDL-FLIKVYQNSA-N |
| XLogP | 0.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,7R)-7-hydroxy-2-[(2S)-2-hydroxypropylidene]octa-3,5-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,7R)-7-hydroxy-2-[(2S)-2-hydroxypropylidene]octa-3,5-dienal?
The IUPAC name of (3E,7R)-7-hydroxy-2-[(2S)-2-hydroxypropylidene]octa-3,5-dienal (CID 170988344) is (3E,7R)-7-hydroxy-2-[(2S)-2-hydroxypropylidene]octa-3,5-dienal.
What is the SMILES notation for (3E,7R)-7-hydroxy-2-[(2S)-2-hydroxypropylidene]octa-3,5-dienal?
The canonical SMILES for (3E,7R)-7-hydroxy-2-[(2S)-2-hydroxypropylidene]octa-3,5-dienal is C[C@H](O)C=C(C=O)/C=C/C=C[C@@H](C)O.
What is the InChIKey of (3E,7R)-7-hydroxy-2-[(2S)-2-hydroxypropylidene]octa-3,5-dienal?
The InChIKey is AACXHGSVRHGLDL-FLIKVYQNSA-N. The full InChI is InChI=1S/C11H16O3/c1-9(13)5-3-4-6-11(8-12)7-10(2)14/h3-10,13-14H,1-2H3/b5-3?,6-4+,11-7?/t9-,10+/m1/s1.
What are the key properties of (3E,7R)-7-hydroxy-2-[(2S)-2-hydroxypropylidene]octa-3,5-dienal?
(3E,7R)-7-hydroxy-2-[(2S)-2-hydroxypropylidene]octa-3,5-dienal has a molecular weight of 196.25 g/mol, XLogP of 0.99, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,7R)-7-hydroxy-2-[(2S)-2-hydroxypropylidene]octa-3,5-dienal is sourced from PubChem (CID 170988344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).