C14H24O5 — CID 170988346
(2R,3S,4S,5E,7S)-3,4,7-trihydroxy-2-pentyl-2,3,4,7,8,9-hexahydrooxecin-10-one (PubChem CID 170988346) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is (2R,3S,4S,5E,7S)-3,4,7-trihydroxy-2-pentyl-2,3,4,7,8,9-hexahydrooxecin-10-one.
| Compound Name | (2R,3S,4S,5E,7S)-3,4,7-trihydroxy-2-pentyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 170988346 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (2R,3S,4S,5E,7S)-3,4,7-trihydroxy-2-pentyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
| SMILES | CCCCC[C@H]1OC(=O)CC[C@H](O)/C=C/[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H24O5/c1-2-3-4-5-12-14(18)11(16)8-6-10(15)7-9-13(17)19-12/h6,8,10-12,14-16,18H,2-5,7,9H2,1H3/b8-6+/t10-,11+,12-,14+/m1/s1 |
| InChIKey | GCUVQXPQQSSMDW-XGXGCATBSA-N |
| XLogP | 0.91 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|