C11H16O3 — CID 170988356
(2Z,4E,6S,7R)-6,7-dihydroxy-2-[(Z)-prop-1-enyl]octa-2,4-dienal (PubChem CID 170988356) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (2Z,4E,6S,7R)-6,7-dihydroxy-2-[(Z)-prop-1-enyl]octa-2,4-dienal.
| Compound Name | (2Z,4E,6S,7R)-6,7-dihydroxy-2-[(Z)-prop-1-enyl]octa-2,4-dienal |
|---|---|
| PubChem CID | 170988356 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (2Z,4E,6S,7R)-6,7-dihydroxy-2-[(Z)-prop-1-enyl]octa-2,4-dienal |
| SMILES | C/C=C\C(C=O)=C\C=C\[C@H](O)[C@@H](C)O |
| InChI | InChI=1S/C11H16O3/c1-3-5-10(8-12)6-4-7-11(14)9(2)13/h3-9,11,13-14H,1-2H3/b5-3-,7-4+,10-6-/t9-,11+/m1/s1 |
| InChIKey | PNXFFHJDTJJMLS-RDAPGITPSA-N |
| XLogP | 0.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|