About 6-[(1S,2R)-1,2-dihydroxypentyl]-4-methoxy-5-methylpyran-2-one
6-[(1S,2R)-1,2-dihydroxypentyl]-4-methoxy-5-methylpyran-2-one (PubChem CID 170988452) has the molecular formula C12H18O5
and a molecular weight of 242.27 g/mol. Its IUPAC name is 6-[(1S,2R)-1,2-dihydroxypentyl]-4-methoxy-5-methylpyran-2-one.
Molecular Properties
| Compound Name | 6-[(1S,2R)-1,2-dihydroxypentyl]-4-methoxy-5-methylpyran-2-one |
| PubChem CID | 170988452 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 6-[(1S,2R)-1,2-dihydroxypentyl]-4-methoxy-5-methylpyran-2-one |
| SMILES | CCC[C@@H](O)[C@H](O)c1oc(=O)cc(OC)c1C |
| InChI | InChI=1S/C12H18O5/c1-4-5-8(13)11(15)12-7(2)9(16-3)6-10(14)17-12/h6,8,11,13,15H,4-5H2,1-3H3/t8-,11+/m1/s1 |
| InChIKey | LYHDGMCYBJZQGO-KCJUWKMLSA-N |
| XLogP | 1.15 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(1S,2R)-1,2-dihydroxypentyl]-4-methoxy-5-methylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1S,2R)-1,2-dihydroxypentyl]-4-methoxy-5-methylpyran-2-one?
The IUPAC name of 6-[(1S,2R)-1,2-dihydroxypentyl]-4-methoxy-5-methylpyran-2-one (CID 170988452) is 6-[(1S,2R)-1,2-dihydroxypentyl]-4-methoxy-5-methylpyran-2-one.
What is the SMILES notation for 6-[(1S,2R)-1,2-dihydroxypentyl]-4-methoxy-5-methylpyran-2-one?
The canonical SMILES for 6-[(1S,2R)-1,2-dihydroxypentyl]-4-methoxy-5-methylpyran-2-one is CCC[C@@H](O)[C@H](O)c1oc(=O)cc(OC)c1C.
What is the InChIKey of 6-[(1S,2R)-1,2-dihydroxypentyl]-4-methoxy-5-methylpyran-2-one?
The InChIKey is LYHDGMCYBJZQGO-KCJUWKMLSA-N. The full InChI is InChI=1S/C12H18O5/c1-4-5-8(13)11(15)12-7(2)9(16-3)6-10(14)17-12/h6,8,11,13,15H,4-5H2,1-3H3/t8-,11+/m1/s1.
What are the key properties of 6-[(1S,2R)-1,2-dihydroxypentyl]-4-methoxy-5-methylpyran-2-one?
6-[(1S,2R)-1,2-dihydroxypentyl]-4-methoxy-5-methylpyran-2-one has a molecular weight of 242.27 g/mol, XLogP of 1.15, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1S,2R)-1,2-dihydroxypentyl]-4-methoxy-5-methylpyran-2-one is sourced from PubChem (CID 170988452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).