C10H18O2 — CID 170988528
(Z,5R,6R)-6-hydroxy-3,5-dimethyloct-2-en-4-one (PubChem CID 170988528) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (Z,5R,6R)-6-hydroxy-3,5-dimethyloct-2-en-4-one.
| Compound Name | (Z,5R,6R)-6-hydroxy-3,5-dimethyloct-2-en-4-one |
|---|---|
| PubChem CID | 170988528 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (Z,5R,6R)-6-hydroxy-3,5-dimethyloct-2-en-4-one |
| SMILES | C/C=C(/C)C(=O)[C@H](C)[C@H](O)CC |
| InChI | InChI=1S/C10H18O2/c1-5-7(3)10(12)8(4)9(11)6-2/h5,8-9,11H,6H2,1-4H3/b7-5-/t8-,9-/m1/s1 |
| InChIKey | WOQKOBKJSKHLDI-XOPPAYCJSA-N |
| XLogP | 1.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|