C20H24O5 — CID 170988537
(1S,5R,8R)-1,3,5-trimethyl-8-[(3E,5E)-2-oxohepta-3,5-dienyl]-2-(2-oxopropyl)-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione (PubChem CID 170988537) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1S,5R,8R)-1,3,5-trimethyl-8-[(3E,5E)-2-oxohepta-3,5-dienyl]-2-(2-oxopropyl)-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione.
| Compound Name | (1S,5R,8R)-1,3,5-trimethyl-8-[(3E,5E)-2-oxohepta-3,5-dienyl]-2-(2-oxopropyl)-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione |
|---|---|
| PubChem CID | 170988537 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (1S,5R,8R)-1,3,5-trimethyl-8-[(3E,5E)-2-oxohepta-3,5-dienyl]-2-(2-oxopropyl)-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione |
| SMILES | C/C=C/C=C/C(=O)C[C@@H]1[C@]2(C)C(=O)O[C@@]1(C)C(=O)C(C)=C2CC(C)=O |
| InChI | InChI=1S/C20H24O5/c1-6-7-8-9-14(22)11-16-19(4)15(10-12(2)21)13(3)17(23)20(16,5)25-18(19)24/h6-9,16H,10-11H2,1-5H3/b7-6+,9-8+/t16-,19-,20-/m1/s1 |
| InChIKey | CDKVKADDNJZMFN-UEMPZYIDSA-N |
| XLogP | 2.89 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|