C13H16N2O2S2 — CID 170988553
(3R,6S)-3-benzyl-3,6-bis(methylsulfanyl)piperazine-2,5-dione (PubChem CID 170988553) has the molecular formula C13H16N2O2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is (3R,6S)-3-benzyl-3,6-bis(methylsulfanyl)piperazine-2,5-dione.
| Compound Name | (3R,6S)-3-benzyl-3,6-bis(methylsulfanyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 170988553 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | (3R,6S)-3-benzyl-3,6-bis(methylsulfanyl)piperazine-2,5-dione |
| SMILES | CS[C@@H]1NC(=O)[C@@](Cc2ccccc2)(SC)NC1=O |
| InChI | InChI=1S/C13H16N2O2S2/c1-18-11-10(16)15-13(19-2,12(17)14-11)8-9-6-4-3-5-7-9/h3-7,11H,8H2,1-2H3,(H,14,17)(H,15,16)/t11-,13+/m0/s1 |
| InChIKey | LDOGKHFLRYUENB-WCQYABFASA-N |
| XLogP | 1.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |