C24H38O8 — CID 170988604
[(3R,3aS,3bR,4R,6aS,7S,7aS)-7-hydroxy-3-(hydroxymethyl)-3-methoxy-3a,5,5-trimethyl-1,2-dioxo-3b,4,6,6a,7,7a-hexahydrocyclopenta[a]pentalen-4-yl] 2-hydroxyoctanoate (PubChem CID 170988604) has the molecular formula C24H38O8 and a molecular weight of 454.56 g/mol. Its IUPAC name is [(3R,3aS,3bR,4R,6aS,7S,7aS)-7-hydroxy-3-(hydroxymethyl)-3-methoxy-3a,5,5-trimethyl-1,2-dioxo-3b,4,6,6a,7,7a-hexahydrocyclopenta[a]pentalen-4-yl] 2-hydroxyoctanoate.
| Compound Name | [(3R,3aS,3bR,4R,6aS,7S,7aS)-7-hydroxy-3-(hydroxymethyl)-3-methoxy-3a,5,5-trimethyl-1,2-dioxo-3b,4,6,6a,7,7a-hexahydrocyclopenta[a]pentalen-4-yl] 2-hydroxyoctanoate |
|---|---|
| PubChem CID | 170988604 |
| Molecular Formula | C24H38O8 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | [(3R,3aS,3bR,4R,6aS,7S,7aS)-7-hydroxy-3-(hydroxymethyl)-3-methoxy-3a,5,5-trimethyl-1,2-dioxo-3b,4,6,6a,7,7a-hexahydrocyclopenta[a]pentalen-4-yl] 2-hydroxyoctanoate |
| SMILES | CCCCCCC(O)C(=O)O[C@@H]1[C@@H]2[C@H](CC1(C)C)[C@H](O)[C@H]1C(=O)C(=O)[C@@](CO)(OC)[C@@]21C |
| InChI | InChI=1S/C24H38O8/c1-6-7-8-9-10-14(26)21(30)32-20-15-13(11-22(20,2)3)17(27)16-18(28)19(29)24(12-25,31-5)23(15,16)4/h13-17,20,25-27H,6-12H2,1-5H3/t13-,14?,15-,16-,17-,20+,23-,24+/m0/s1 |
| InChIKey | GBUDEGRTSQQFSS-YMGWITSCSA-N |
| XLogP | 1.42 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|