C15H22O6 — CID 170988650
[(1S,5S)-5-ethyl-5-hydroxy-4-methoxy-1-methyl-2,6-dioxocyclohex-3-en-1-yl] (2R)-2-methylbutanoate (PubChem CID 170988650) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is [(1S,5S)-5-ethyl-5-hydroxy-4-methoxy-1-methyl-2,6-dioxocyclohex-3-en-1-yl] (2R)-2-methylbutanoate.
| Compound Name | [(1S,5S)-5-ethyl-5-hydroxy-4-methoxy-1-methyl-2,6-dioxocyclohex-3-en-1-yl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 170988650 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [(1S,5S)-5-ethyl-5-hydroxy-4-methoxy-1-methyl-2,6-dioxocyclohex-3-en-1-yl] (2R)-2-methylbutanoate |
| SMILES | CC[C@@H](C)C(=O)O[C@@]1(C)C(=O)C=C(OC)[C@@](O)(CC)C1=O |
| InChI | InChI=1S/C15H22O6/c1-6-9(3)12(17)21-14(4)10(16)8-11(20-5)15(19,7-2)13(14)18/h8-9,19H,6-7H2,1-5H3/t9-,14+,15+/m1/s1 |
| InChIKey | ZADJZUMOFDVXSD-NKZPBKNFSA-N |
| XLogP | 1.16 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|