About 6-[(2S,6S)-6-ethyl-2-methoxyoxan-2-yl]-4-methoxypyran-2-one
6-[(2S,6S)-6-ethyl-2-methoxyoxan-2-yl]-4-methoxypyran-2-one (PubChem CID 170988716) has the molecular formula C14H20O5
and a molecular weight of 268.31 g/mol. Its IUPAC name is 6-[(2S,6S)-6-ethyl-2-methoxyoxan-2-yl]-4-methoxypyran-2-one.
Molecular Properties
| Compound Name | 6-[(2S,6S)-6-ethyl-2-methoxyoxan-2-yl]-4-methoxypyran-2-one |
| PubChem CID | 170988716 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 6-[(2S,6S)-6-ethyl-2-methoxyoxan-2-yl]-4-methoxypyran-2-one |
| SMILES | CC[C@H]1CCC[C@@](OC)(c2cc(OC)cc(=O)o2)O1 |
| InChI | InChI=1S/C14H20O5/c1-4-10-6-5-7-14(17-3,19-10)12-8-11(16-2)9-13(15)18-12/h8-10H,4-7H2,1-3H3/t10-,14-/m0/s1 |
| InChIKey | OCAHQLKLVJQRRU-HZMBPMFUSA-N |
| XLogP | 2.43 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(2S,6S)-6-ethyl-2-methoxyoxan-2-yl]-4-methoxypyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2S,6S)-6-ethyl-2-methoxyoxan-2-yl]-4-methoxypyran-2-one?
The IUPAC name of 6-[(2S,6S)-6-ethyl-2-methoxyoxan-2-yl]-4-methoxypyran-2-one (CID 170988716) is 6-[(2S,6S)-6-ethyl-2-methoxyoxan-2-yl]-4-methoxypyran-2-one.
What is the SMILES notation for 6-[(2S,6S)-6-ethyl-2-methoxyoxan-2-yl]-4-methoxypyran-2-one?
The canonical SMILES for 6-[(2S,6S)-6-ethyl-2-methoxyoxan-2-yl]-4-methoxypyran-2-one is CC[C@H]1CCC[C@@](OC)(c2cc(OC)cc(=O)o2)O1.
What is the InChIKey of 6-[(2S,6S)-6-ethyl-2-methoxyoxan-2-yl]-4-methoxypyran-2-one?
The InChIKey is OCAHQLKLVJQRRU-HZMBPMFUSA-N. The full InChI is InChI=1S/C14H20O5/c1-4-10-6-5-7-14(17-3,19-10)12-8-11(16-2)9-13(15)18-12/h8-10H,4-7H2,1-3H3/t10-,14-/m0/s1.
What are the key properties of 6-[(2S,6S)-6-ethyl-2-methoxyoxan-2-yl]-4-methoxypyran-2-one?
6-[(2S,6S)-6-ethyl-2-methoxyoxan-2-yl]-4-methoxypyran-2-one has a molecular weight of 268.31 g/mol, XLogP of 2.43, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2S,6S)-6-ethyl-2-methoxyoxan-2-yl]-4-methoxypyran-2-one is sourced from PubChem (CID 170988716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).