C21H26O5 — CID 170988807
[(1R,2S,8aS)-7-hydroxy-1,8a-dimethyl-6-oxo-1,2-dihydronaphthalen-2-yl] (2E,4E,6S)-6-hydroxy-6-methylocta-2,4-dienoate (PubChem CID 170988807) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is [(1R,2S,8aS)-7-hydroxy-1,8a-dimethyl-6-oxo-1,2-dihydronaphthalen-2-yl] (2E,4E,6S)-6-hydroxy-6-methylocta-2,4-dienoate.
| Compound Name | [(1R,2S,8aS)-7-hydroxy-1,8a-dimethyl-6-oxo-1,2-dihydronaphthalen-2-yl] (2E,4E,6S)-6-hydroxy-6-methylocta-2,4-dienoate |
|---|---|
| PubChem CID | 170988807 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | [(1R,2S,8aS)-7-hydroxy-1,8a-dimethyl-6-oxo-1,2-dihydronaphthalen-2-yl] (2E,4E,6S)-6-hydroxy-6-methylocta-2,4-dienoate |
| SMILES | CC[C@](C)(O)/C=C/C=C/C(=O)O[C@H]1C=CC2=CC(=O)C(O)=C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C21H26O5/c1-5-20(3,25)11-7-6-8-19(24)26-18-10-9-15-12-16(22)17(23)13-21(15,4)14(18)2/h6-14,18,23,25H,5H2,1-4H3/b8-6+,11-7+/t14-,18-,20-,21+/m0/s1 |
| InChIKey | WEJDAVYJYCWEAJ-YZELPXSCSA-N |
| XLogP | 3.33 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|