C21H19NO5 — CID 170988828
methyl 2-[2-[(1S)-5,8-dihydroxy-4-oxo-2,3-dihydro-1H-naphthalen-1-yl]-1H-indol-3-yl]acetate (PubChem CID 170988828) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is methyl 2-[2-[(1S)-5,8-dihydroxy-4-oxo-2,3-dihydro-1H-naphthalen-1-yl]-1H-indol-3-yl]acetate.
| Compound Name | methyl 2-[2-[(1S)-5,8-dihydroxy-4-oxo-2,3-dihydro-1H-naphthalen-1-yl]-1H-indol-3-yl]acetate |
|---|---|
| PubChem CID | 170988828 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | methyl 2-[2-[(1S)-5,8-dihydroxy-4-oxo-2,3-dihydro-1H-naphthalen-1-yl]-1H-indol-3-yl]acetate |
| SMILES | COC(=O)Cc1c([C@H]2CCC(=O)c3c(O)ccc(O)c32)[nH]c2ccccc12 |
| InChI | InChI=1S/C21H19NO5/c1-27-18(26)10-13-11-4-2-3-5-14(11)22-21(13)12-6-7-16(24)20-17(25)9-8-15(23)19(12)20/h2-5,8-9,12,22-23,25H,6-7,10H2,1H3/t12-/m0/s1 |
| InChIKey | IOQWFECCVMDTEV-LBPRGKRZSA-N |
| XLogP | 3.40 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|