C14H16O3 — CID 170988933
1-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-1,3-dihydro-2-benzofuran-4-ol (PubChem CID 170988933) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-1,3-dihydro-2-benzofuran-4-ol.
| Compound Name | 1-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-1,3-dihydro-2-benzofuran-4-ol |
|---|---|
| PubChem CID | 170988933 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 1-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-1,3-dihydro-2-benzofuran-4-ol |
| SMILES | CC(O)/C=C/C=C/C1OCc2c(O)cccc21 |
| InChI | InChI=1S/C14H16O3/c1-10(15)5-2-3-8-14-11-6-4-7-13(16)12(11)9-17-14/h2-8,10,14-16H,9H2,1H3/b5-2+,8-3+ |
| InChIKey | ZRXNEAWUHJIGDY-QKVOYMTASA-N |
| XLogP | 2.46 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|