C30H32O9 — CID 170988940
(7S)-7-[2-(2,5-dihydroxyphenyl)-2-oxoethyl]-3-[(E)-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-4-methylpent-3-enyl]-5,6-dihydro-2H-oxepine-7-carboxylic acid (PubChem CID 170988940) has the molecular formula C30H32O9 and a molecular weight of 536.58 g/mol. Its IUPAC name is (7S)-7-[2-(2,5-dihydroxyphenyl)-2-oxoethyl]-3-[(E)-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-4-methylpent-3-enyl]-5,6-dihydro-2H-oxepine-7-carboxylic acid.
| Compound Name | (7S)-7-[2-(2,5-dihydroxyphenyl)-2-oxoethyl]-3-[(E)-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-4-methylpent-3-enyl]-5,6-dihydro-2H-oxepine-7-carboxylic acid |
|---|---|
| PubChem CID | 170988940 |
| Molecular Formula | C30H32O9 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | (7S)-7-[2-(2,5-dihydroxyphenyl)-2-oxoethyl]-3-[(E)-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-4-methylpent-3-enyl]-5,6-dihydro-2H-oxepine-7-carboxylic acid |
| SMILES | C/C(=C\CCC1=CCC[C@](CC(=O)c2cc(O)ccc2O)(C(=O)O)OC1)COC(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C30H32O9/c1-20(18-38-28(35)14-9-21-7-10-23(31)11-8-21)4-2-5-22-6-3-15-30(29(36)37,39-19-22)17-27(34)25-16-24(32)12-13-26(25)33/h4,6-14,16,31-33H,2-3,5,15,17-19H2,1H3,(H,36,37)/b14-9+,20-4+/t30-/m0/s1 |
| InChIKey | LCSAMIGLSLPDEG-MEQYLWRISA-N |
| XLogP | 4.92 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|