About Purpurolide E
Purpurolide E (PubChem CID 170989021) has the molecular formula C14H16O5
and a molecular weight of 264.28 g/mol.
Molecular Properties
| Compound Name | Purpurolide E |
| PubChem CID | 170989021 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | — |
| SMILES | C[C@]12O[C@H]1[C@]1(OC[C@@]3(C4C=CCC3C4)[C@H]1O)OC2=O |
| InChI | InChI=1S/C14H16O5/c1-12-10(18-12)14(19-11(12)16)9(15)13(6-17-14)7-3-2-4-8(13)5-7/h2-3,7-10,15H,4-6H2,1H3/t7?,8?,9-,10-,12+,13+,14-/m1/s1 |
| InChIKey | XZCNIFLXWCLEDJ-MNHOAAQLSA-N |
| XLogP | 0.37 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze Purpurolide E with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Purpurolide E?
The IUPAC name of Purpurolide E (CID 170989021) is not available.
What is the SMILES notation for Purpurolide E?
The canonical SMILES for Purpurolide E is C[C@]12O[C@H]1[C@]1(OC[C@@]3(C4C=CCC3C4)[C@H]1O)OC2=O.
What is the InChIKey of Purpurolide E?
The InChIKey is XZCNIFLXWCLEDJ-MNHOAAQLSA-N. The full InChI is InChI=1S/C14H16O5/c1-12-10(18-12)14(19-11(12)16)9(15)13(6-17-14)7-3-2-4-8(13)5-7/h2-3,7-10,15H,4-6H2,1H3/t7?,8?,9-,10-,12+,13+,14-/m1/s1.
What are the key properties of Purpurolide E?
Purpurolide E has a molecular weight of 264.28 g/mol, XLogP of 0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Purpurolide E is sourced from PubChem (CID 170989021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).