C15H20O5 — CID 170989048
(1R,6S,7R)-7-[(E,1S)-4-carboxy-1-hydroxypent-3-enyl]-7-methylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid (PubChem CID 170989048) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (1R,6S,7R)-7-[(E,1S)-4-carboxy-1-hydroxypent-3-enyl]-7-methylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid.
| Compound Name | (1R,6S,7R)-7-[(E,1S)-4-carboxy-1-hydroxypent-3-enyl]-7-methylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 170989048 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (1R,6S,7R)-7-[(E,1S)-4-carboxy-1-hydroxypent-3-enyl]-7-methylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid |
| SMILES | C/C(=C\C[C@H](O)[C@@]1(C)[C@@H]2C=C(C(=O)O)CC[C@@H]21)C(=O)O |
| InChI | InChI=1S/C15H20O5/c1-8(13(17)18)3-6-12(16)15(2)10-5-4-9(14(19)20)7-11(10)15/h3,7,10-12,16H,4-6H2,1-2H3,(H,17,18)(H,19,20)/b8-3+/t10-,11+,12-,15+/m0/s1 |
| InChIKey | DUTOFLKWGZOJIC-KUPBRIPVSA-N |
| XLogP | 1.83 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|