About 4-hydroxy-3,5-dimethyl-6-[(2R)-3-oxobutan-2-yl]pyran-2-one
4-hydroxy-3,5-dimethyl-6-[(2R)-3-oxobutan-2-yl]pyran-2-one (PubChem CID 170989203) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is 4-hydroxy-3,5-dimethyl-6-[(2R)-3-oxobutan-2-yl]pyran-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-3,5-dimethyl-6-[(2R)-3-oxobutan-2-yl]pyran-2-one |
| PubChem CID | 170989203 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 4-hydroxy-3,5-dimethyl-6-[(2R)-3-oxobutan-2-yl]pyran-2-one |
| SMILES | CC(=O)[C@H](C)c1oc(=O)c(C)c(O)c1C |
| InChI | InChI=1S/C11H14O4/c1-5(8(4)12)10-6(2)9(13)7(3)11(14)15-10/h5,13H,1-4H3/t5-/m0/s1 |
| InChIKey | FPFHZARMGGXZGQ-YFKPBYRVSA-N |
| XLogP | 1.65 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-3,5-dimethyl-6-[(2R)-3-oxobutan-2-yl]pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3,5-dimethyl-6-[(2R)-3-oxobutan-2-yl]pyran-2-one?
The IUPAC name of 4-hydroxy-3,5-dimethyl-6-[(2R)-3-oxobutan-2-yl]pyran-2-one (CID 170989203) is 4-hydroxy-3,5-dimethyl-6-[(2R)-3-oxobutan-2-yl]pyran-2-one.
What is the SMILES notation for 4-hydroxy-3,5-dimethyl-6-[(2R)-3-oxobutan-2-yl]pyran-2-one?
The canonical SMILES for 4-hydroxy-3,5-dimethyl-6-[(2R)-3-oxobutan-2-yl]pyran-2-one is CC(=O)[C@H](C)c1oc(=O)c(C)c(O)c1C.
What is the InChIKey of 4-hydroxy-3,5-dimethyl-6-[(2R)-3-oxobutan-2-yl]pyran-2-one?
The InChIKey is FPFHZARMGGXZGQ-YFKPBYRVSA-N. The full InChI is InChI=1S/C11H14O4/c1-5(8(4)12)10-6(2)9(13)7(3)11(14)15-10/h5,13H,1-4H3/t5-/m0/s1.
What are the key properties of 4-hydroxy-3,5-dimethyl-6-[(2R)-3-oxobutan-2-yl]pyran-2-one?
4-hydroxy-3,5-dimethyl-6-[(2R)-3-oxobutan-2-yl]pyran-2-one has a molecular weight of 210.23 g/mol, XLogP of 1.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3,5-dimethyl-6-[(2R)-3-oxobutan-2-yl]pyran-2-one is sourced from PubChem (CID 170989203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).