C27H31NO7 — CID 170989290
(3S,6S,9S,13S)-6-benzyl-9,10-dimethyl-13-phenyl-3-propan-2-yl-1,4,7-trioxa-10-azacyclotridecane-2,5,8,11-tetrone (PubChem CID 170989290) has the molecular formula C27H31NO7 and a molecular weight of 481.55 g/mol. Its IUPAC name is (3S,6S,9S,13S)-6-benzyl-9,10-dimethyl-13-phenyl-3-propan-2-yl-1,4,7-trioxa-10-azacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,13S)-6-benzyl-9,10-dimethyl-13-phenyl-3-propan-2-yl-1,4,7-trioxa-10-azacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 170989290 |
| Molecular Formula | C27H31NO7 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | (3S,6S,9S,13S)-6-benzyl-9,10-dimethyl-13-phenyl-3-propan-2-yl-1,4,7-trioxa-10-azacyclotridecane-2,5,8,11-tetrone |
| SMILES | CC(C)[C@@H]1OC(=O)[C@H](Cc2ccccc2)OC(=O)[C@H](C)N(C)C(=O)C[C@@H](c2ccccc2)OC1=O |
| InChI | InChI=1S/C27H31NO7/c1-17(2)24-27(32)33-21(20-13-9-6-10-14-20)16-23(29)28(4)18(3)25(30)34-22(26(31)35-24)15-19-11-7-5-8-12-19/h5-14,17-18,21-22,24H,15-16H2,1-4H3/t18-,21-,22-,24-/m0/s1 |
| InChIKey | PFOJLPLRVMMXRG-CKLTXHEASA-N |
| XLogP | 3.24 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|