C9H14N2O2 — CID 170989298
(3S)-3-butan-2-yl-6-methylidenepiperazine-2,5-dione (PubChem CID 170989298) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is (3S)-3-butan-2-yl-6-methylidenepiperazine-2,5-dione.
| Compound Name | (3S)-3-butan-2-yl-6-methylidenepiperazine-2,5-dione |
|---|---|
| PubChem CID | 170989298 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (3S)-3-butan-2-yl-6-methylidenepiperazine-2,5-dione |
| SMILES | C=C1NC(=O)[C@H](C(C)CC)NC1=O |
| InChI | InChI=1S/C9H14N2O2/c1-4-5(2)7-9(13)10-6(3)8(12)11-7/h5,7H,3-4H2,1-2H3,(H,10,13)(H,11,12)/t5?,7-/m0/s1 |
| InChIKey | FNGPTPRUFOMOAS-MSZQBOFLSA-N |
| XLogP | 0.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|