C33H38N4O2 — CID 170989388
(1S,4R,12R,14S,17R,25R)-5-methyl-12,25-bis(3-methylbut-2-enyl)-3,5,16,18-tetrazaheptacyclo[14.10.0.03,14.04,12.06,11.017,25.019,24]hexacosa-6,8,10,19,21,23-hexaene-2,15-dione (PubChem CID 170989388) has the molecular formula C33H38N4O2 and a molecular weight of 522.69 g/mol. Its IUPAC name is (1S,4R,12R,14S,17R,25R)-5-methyl-12,25-bis(3-methylbut-2-enyl)-3,5,16,18-tetrazaheptacyclo[14.10.0.03,14.04,12.06,11.017,25.019,24]hexacosa-6,8,10,19,21,23-hexaene-2,15-dione.
| Compound Name | (1S,4R,12R,14S,17R,25R)-5-methyl-12,25-bis(3-methylbut-2-enyl)-3,5,16,18-tetrazaheptacyclo[14.10.0.03,14.04,12.06,11.017,25.019,24]hexacosa-6,8,10,19,21,23-hexaene-2,15-dione |
|---|---|
| PubChem CID | 170989388 |
| Molecular Formula | C33H38N4O2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | (1S,4R,12R,14S,17R,25R)-5-methyl-12,25-bis(3-methylbut-2-enyl)-3,5,16,18-tetrazaheptacyclo[14.10.0.03,14.04,12.06,11.017,25.019,24]hexacosa-6,8,10,19,21,23-hexaene-2,15-dione |
| SMILES | CC(C)=CC[C@]12C[C@H]3C(=O)N4[C@H]5N(C)c6ccccc6[C@@]5(CC=C(C)C)C[C@H]4C(=O)N3[C@H]1Nc1ccccc12 |
| InChI | InChI=1S/C33H38N4O2/c1-20(2)14-16-32-18-26-29(39)37-27(28(38)36(26)30(32)34-24-12-8-6-10-22(24)32)19-33(17-15-21(3)4)23-11-7-9-13-25(23)35(5)31(33)37/h6-15,26-27,30-31,34H,16-19H2,1-5H3/t26-,27-,30+,31+,32+,33+/m0/s1 |
| InChIKey | DBLDJVISTIQRHL-USRUFDFGSA-N |
| XLogP | 5.32 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|