C15H26O3 — CID 170989452
(3R,4aS,9S,9aS)-9-hydroxy-6,6,9-trimethyl-2,3,4,4a,5,7,8,9a-octahydro-1H-benzo[7]annulene-3-carboxylic acid (PubChem CID 170989452) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (3R,4aS,9S,9aS)-9-hydroxy-6,6,9-trimethyl-2,3,4,4a,5,7,8,9a-octahydro-1H-benzo[7]annulene-3-carboxylic acid.
| Compound Name | (3R,4aS,9S,9aS)-9-hydroxy-6,6,9-trimethyl-2,3,4,4a,5,7,8,9a-octahydro-1H-benzo[7]annulene-3-carboxylic acid |
|---|---|
| PubChem CID | 170989452 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (3R,4aS,9S,9aS)-9-hydroxy-6,6,9-trimethyl-2,3,4,4a,5,7,8,9a-octahydro-1H-benzo[7]annulene-3-carboxylic acid |
| SMILES | CC1(C)CC[C@](C)(O)[C@H]2CC[C@@H](C(=O)O)C[C@H]2C1 |
| InChI | InChI=1S/C15H26O3/c1-14(2)6-7-15(3,18)12-5-4-10(13(16)17)8-11(12)9-14/h10-12,18H,4-9H2,1-3H3,(H,16,17)/t10-,11+,12+,15+/m1/s1 |
| InChIKey | BBGXMYGNMQUBIM-YXMPFFBPSA-N |
| XLogP | 3.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |