About 3-[(E,1S)-1-hydroxybut-2-enyl]-4-[(2S)-2-hydroxypropyl]-2H-furan-5-one
3-[(E,1S)-1-hydroxybut-2-enyl]-4-[(2S)-2-hydroxypropyl]-2H-furan-5-one (PubChem CID 170989537) has the molecular formula C11H16O4
and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-[(E,1S)-1-hydroxybut-2-enyl]-4-[(2S)-2-hydroxypropyl]-2H-furan-5-one.
Molecular Properties
| Compound Name | 3-[(E,1S)-1-hydroxybut-2-enyl]-4-[(2S)-2-hydroxypropyl]-2H-furan-5-one |
| PubChem CID | 170989537 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 3-[(E,1S)-1-hydroxybut-2-enyl]-4-[(2S)-2-hydroxypropyl]-2H-furan-5-one |
| SMILES | C/C=C/[C@H](O)C1=C(C[C@H](C)O)C(=O)OC1 |
| InChI | InChI=1S/C11H16O4/c1-3-4-10(13)9-6-15-11(14)8(9)5-7(2)12/h3-4,7,10,12-13H,5-6H2,1-2H3/b4-3+/t7-,10-/m0/s1 |
| InChIKey | IATOJJRGMZUSQH-BRUQVKLWSA-N |
| XLogP | 0.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E,1S)-1-hydroxybut-2-enyl]-4-[(2S)-2-hydroxypropyl]-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E,1S)-1-hydroxybut-2-enyl]-4-[(2S)-2-hydroxypropyl]-2H-furan-5-one?
The IUPAC name of 3-[(E,1S)-1-hydroxybut-2-enyl]-4-[(2S)-2-hydroxypropyl]-2H-furan-5-one (CID 170989537) is 3-[(E,1S)-1-hydroxybut-2-enyl]-4-[(2S)-2-hydroxypropyl]-2H-furan-5-one.
What is the SMILES notation for 3-[(E,1S)-1-hydroxybut-2-enyl]-4-[(2S)-2-hydroxypropyl]-2H-furan-5-one?
The canonical SMILES for 3-[(E,1S)-1-hydroxybut-2-enyl]-4-[(2S)-2-hydroxypropyl]-2H-furan-5-one is C/C=C/[C@H](O)C1=C(C[C@H](C)O)C(=O)OC1.
What is the InChIKey of 3-[(E,1S)-1-hydroxybut-2-enyl]-4-[(2S)-2-hydroxypropyl]-2H-furan-5-one?
The InChIKey is IATOJJRGMZUSQH-BRUQVKLWSA-N. The full InChI is InChI=1S/C11H16O4/c1-3-4-10(13)9-6-15-11(14)8(9)5-7(2)12/h3-4,7,10,12-13H,5-6H2,1-2H3/b4-3+/t7-,10-/m0/s1.
What are the key properties of 3-[(E,1S)-1-hydroxybut-2-enyl]-4-[(2S)-2-hydroxypropyl]-2H-furan-5-one?
3-[(E,1S)-1-hydroxybut-2-enyl]-4-[(2S)-2-hydroxypropyl]-2H-furan-5-one has a molecular weight of 212.25 g/mol, XLogP of 0.55, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E,1S)-1-hydroxybut-2-enyl]-4-[(2S)-2-hydroxypropyl]-2H-furan-5-one is sourced from PubChem (CID 170989537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).