C20H30O4 — CID 170989547
(1S,2R,5S,10R,12R,13R,14R)-13-(hydroxymethyl)-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadeca-6,8-diene-1,14-diol (PubChem CID 170989547) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,2R,5S,10R,12R,13R,14R)-13-(hydroxymethyl)-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadeca-6,8-diene-1,14-diol.
| Compound Name | (1S,2R,5S,10R,12R,13R,14R)-13-(hydroxymethyl)-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadeca-6,8-diene-1,14-diol |
|---|---|
| PubChem CID | 170989547 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1S,2R,5S,10R,12R,13R,14R)-13-(hydroxymethyl)-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadeca-6,8-diene-1,14-diol |
| SMILES | CC(C)C1=C2[C@H]3C[C@H]4O[C@](O)([C@H](O)[C@H]4CO)[C@]3(C)CC[C@@]2(C)C=C1 |
| InChI | InChI=1S/C20H30O4/c1-11(2)12-5-6-18(3)7-8-19(4)14(16(12)18)9-15-13(10-21)17(22)20(19,23)24-15/h5-6,11,13-15,17,21-23H,7-10H2,1-4H3/t13-,14+,15+,17+,18+,19+,20+/m0/s1 |
| InChIKey | XDTZGMNHQDYUSW-COGHNSAZSA-N |
| XLogP | 2.39 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |