About Xylaripyone A
Xylaripyone A (PubChem CID 170989632) has the molecular formula C11H12O7
and a molecular weight of 256.21 g/mol. Its IUPAC name is 3-(4-methoxy-3-methoxycarbonyl-6-oxopyran-2-yl)propanoic acid.
Molecular Properties
| Compound Name | Xylaripyone A |
| PubChem CID | 170989632 |
| Molecular Formula | C11H12O7 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 3-(4-methoxy-3-methoxycarbonyl-6-oxopyran-2-yl)propanoic acid |
| SMILES | COC1=CC(=O)OC(=C1C(=O)OC)CCC(=O)O |
| InChI | InChI=1S/C11H12O7/c1-16-7-5-9(14)18-6(3-4-8(12)13)10(7)11(15)17-2/h5H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | VVOLQKOBDQMSKM-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | 444 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze Xylaripyone A with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Xylaripyone A?
The IUPAC name of Xylaripyone A (CID 170989632) is 3-(4-methoxy-3-methoxycarbonyl-6-oxopyran-2-yl)propanoic acid.
What is the SMILES notation for Xylaripyone A?
The canonical SMILES for Xylaripyone A is COC1=CC(=O)OC(=C1C(=O)OC)CCC(=O)O.
What is the InChIKey of Xylaripyone A?
The InChIKey is VVOLQKOBDQMSKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O7/c1-16-7-5-9(14)18-6(3-4-8(12)13)10(7)11(15)17-2/h5H,3-4H2,1-2H3,(H,12,13).
What are the key properties of Xylaripyone A?
Xylaripyone A has a molecular weight of 256.21 g/mol, XLogP of -0.20, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Xylaripyone A is sourced from PubChem (CID 170989632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).