C16H20O4 — CID 170989648
(1R,2R,5R,6S)-1-[(Z)-4-hydroxy-3-methylbut-2-enyl]-3-(3-methylbut-3-en-1-ynyl)-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol (PubChem CID 170989648) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (1R,2R,5R,6S)-1-[(Z)-4-hydroxy-3-methylbut-2-enyl]-3-(3-methylbut-3-en-1-ynyl)-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol.
| Compound Name | (1R,2R,5R,6S)-1-[(Z)-4-hydroxy-3-methylbut-2-enyl]-3-(3-methylbut-3-en-1-ynyl)-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol |
|---|---|
| PubChem CID | 170989648 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (1R,2R,5R,6S)-1-[(Z)-4-hydroxy-3-methylbut-2-enyl]-3-(3-methylbut-3-en-1-ynyl)-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol |
| SMILES | C=C(C)C#CC1=C[C@@H](O)[C@@H]2O[C@]2(C/C=C(/C)CO)[C@@H]1O |
| InChI | InChI=1S/C16H20O4/c1-10(2)4-5-12-8-13(18)15-16(20-15,14(12)19)7-6-11(3)9-17/h6,8,13-15,17-19H,1,7,9H2,2-3H3/b11-6-/t13-,14-,15+,16-/m1/s1 |
| InChIKey | KLEYYWFOZRQLKP-HJLHVWOGSA-N |
| XLogP | 0.69 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|