C15H26O3 — CID 170989688
(3S,3aS,3bR,6aR,7aS)-3-(hydroxymethyl)-3a,5,5-trimethyl-2,3b,4,6,6a,7-hexahydro-1H-cyclopenta[a]pentalene-3,7a-diol (PubChem CID 170989688) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (3S,3aS,3bR,6aR,7aS)-3-(hydroxymethyl)-3a,5,5-trimethyl-2,3b,4,6,6a,7-hexahydro-1H-cyclopenta[a]pentalene-3,7a-diol.
| Compound Name | (3S,3aS,3bR,6aR,7aS)-3-(hydroxymethyl)-3a,5,5-trimethyl-2,3b,4,6,6a,7-hexahydro-1H-cyclopenta[a]pentalene-3,7a-diol |
|---|---|
| PubChem CID | 170989688 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (3S,3aS,3bR,6aR,7aS)-3-(hydroxymethyl)-3a,5,5-trimethyl-2,3b,4,6,6a,7-hexahydro-1H-cyclopenta[a]pentalene-3,7a-diol |
| SMILES | CC1(C)C[C@@H]2C[C@@]3(O)CC[C@@](O)(CO)[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C15H26O3/c1-12(2)6-10-7-14(17)4-5-15(18,9-16)13(14,3)11(10)8-12/h10-11,16-18H,4-9H2,1-3H3/t10-,11-,13+,14+,15-/m1/s1 |
| InChIKey | JFRXTFKWEKHCKW-NKQKNBIVSA-N |
| XLogP | 1.70 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |