C15H24O3 — CID 170989689
(1R,3R,3aR,3bR,6aS,7aS)-3,3a-dihydroxy-1,5,5,7a-tetramethyl-2,3,3b,4,6,6a-hexahydro-1H-cyclopenta[a]pentalen-7-one (PubChem CID 170989689) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1R,3R,3aR,3bR,6aS,7aS)-3,3a-dihydroxy-1,5,5,7a-tetramethyl-2,3,3b,4,6,6a-hexahydro-1H-cyclopenta[a]pentalen-7-one.
| Compound Name | (1R,3R,3aR,3bR,6aS,7aS)-3,3a-dihydroxy-1,5,5,7a-tetramethyl-2,3,3b,4,6,6a-hexahydro-1H-cyclopenta[a]pentalen-7-one |
|---|---|
| PubChem CID | 170989689 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1R,3R,3aR,3bR,6aS,7aS)-3,3a-dihydroxy-1,5,5,7a-tetramethyl-2,3,3b,4,6,6a-hexahydro-1H-cyclopenta[a]pentalen-7-one |
| SMILES | C[C@@H]1C[C@@H](O)[C@@]2(O)[C@@H]3CC(C)(C)C[C@@H]3C(=O)[C@@]12C |
| InChI | InChI=1S/C15H24O3/c1-8-5-11(16)15(18)10-7-13(2,3)6-9(10)12(17)14(8,15)4/h8-11,16,18H,5-7H2,1-4H3/t8-,9+,10-,11-,14-,15+/m1/s1 |
| InChIKey | VZVZPNBCEVMJDM-YIBGNZATSA-N |
| XLogP | 1.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |