C15H20O3 — CID 170989693
(3R,3aR,3bR,5S,6aS)-3,3a,5-trimethyl-2-oxo-3,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalene-5-carboxylic acid (PubChem CID 170989693) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (3R,3aR,3bR,5S,6aS)-3,3a,5-trimethyl-2-oxo-3,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalene-5-carboxylic acid.
| Compound Name | (3R,3aR,3bR,5S,6aS)-3,3a,5-trimethyl-2-oxo-3,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalene-5-carboxylic acid |
|---|---|
| PubChem CID | 170989693 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3R,3aR,3bR,5S,6aS)-3,3a,5-trimethyl-2-oxo-3,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalene-5-carboxylic acid |
| SMILES | C[C@H]1C(=O)C=C2C[C@H]3C[C@](C)(C(=O)O)C[C@H]3[C@@]21C |
| InChI | InChI=1S/C15H20O3/c1-8-12(16)5-10-4-9-6-14(2,13(17)18)7-11(9)15(8,10)3/h5,8-9,11H,4,6-7H2,1-3H3,(H,17,18)/t8-,9-,11+,14-,15+/m0/s1 |
| InChIKey | CUSIDQGYTZTOJO-NYWQGFLHSA-N |
| XLogP | 2.66 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |