C16H26O4 — CID 170989701
methyl (2R,3R,3aR,3bR,5S,6aR,7aR)-2,7a-dihydroxy-3,3a,5-trimethyl-1,2,3,3b,4,6,6a,7-octahydrocyclopenta[a]pentalene-5-carboxylate (PubChem CID 170989701) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is methyl (2R,3R,3aR,3bR,5S,6aR,7aR)-2,7a-dihydroxy-3,3a,5-trimethyl-1,2,3,3b,4,6,6a,7-octahydrocyclopenta[a]pentalene-5-carboxylate.
| Compound Name | methyl (2R,3R,3aR,3bR,5S,6aR,7aR)-2,7a-dihydroxy-3,3a,5-trimethyl-1,2,3,3b,4,6,6a,7-octahydrocyclopenta[a]pentalene-5-carboxylate |
|---|---|
| PubChem CID | 170989701 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | methyl (2R,3R,3aR,3bR,5S,6aR,7aR)-2,7a-dihydroxy-3,3a,5-trimethyl-1,2,3,3b,4,6,6a,7-octahydrocyclopenta[a]pentalene-5-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C[C@@H]2C[C@@]3(O)C[C@@H](O)[C@H](C)[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C16H26O4/c1-9-12(17)8-16(19)6-10-5-14(2,13(18)20-4)7-11(10)15(9,16)3/h9-12,17,19H,5-8H2,1-4H3/t9-,10+,11+,12+,14-,15-,16+/m0/s1 |
| InChIKey | RPRPGAOOAJZJAF-NQRQKEJUSA-N |
| XLogP | 1.73 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |