C30H39NO5 — CID 170989726
[(1S,2R,3E,5R,7S,9E,11S,14S,15R,16R)-5-hydroxy-16-[(S)-hydroxy(phenyl)methyl]-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-2-yl] acetate (PubChem CID 170989726) has the molecular formula C30H39NO5 and a molecular weight of 493.64 g/mol. Its IUPAC name is [(1S,2R,3E,5R,7S,9E,11S,14S,15R,16R)-5-hydroxy-16-[(S)-hydroxy(phenyl)methyl]-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-2-yl] acetate.
| Compound Name | [(1S,2R,3E,5R,7S,9E,11S,14S,15R,16R)-5-hydroxy-16-[(S)-hydroxy(phenyl)methyl]-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-2-yl] acetate |
|---|---|
| PubChem CID | 170989726 |
| Molecular Formula | C30H39NO5 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | [(1S,2R,3E,5R,7S,9E,11S,14S,15R,16R)-5-hydroxy-16-[(S)-hydroxy(phenyl)methyl]-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1/C=C/[C@](C)(O)C[C@@H](C)C/C=C/[C@H]2C=C(C)[C@@H](C)[C@H]3[C@H]([C@@H](O)c4ccccc4)NC(=O)[C@]321 |
| InChI | InChI=1S/C30H39NO5/c1-18-10-9-13-23-16-19(2)20(3)25-26(27(33)22-11-7-6-8-12-22)31-28(34)30(23,25)24(36-21(4)32)14-15-29(5,35)17-18/h6-9,11-16,18,20,23-27,33,35H,10,17H2,1-5H3,(H,31,34)/b13-9+,15-14+/t18-,20+,23-,24+,25-,26+,27-,29-,30+/m0/s1 |
| InChIKey | GQJTZUBHCMVKGA-IJWFZUFLSA-N |
| XLogP | 4.26 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|