C26H34O6 — CID 170989747
[(1R,4R,4aS,6Z)-4-hydroxy-6-(1-methoxy-1-oxopropan-2-ylidene)-4,4a-dimethyl-7-oxo-1,2,3,5-tetrahydronaphthalen-1-yl] (2E,4E,6E)-deca-2,4,6-trienoate (PubChem CID 170989747) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is [(1R,4R,4aS,6Z)-4-hydroxy-6-(1-methoxy-1-oxopropan-2-ylidene)-4,4a-dimethyl-7-oxo-1,2,3,5-tetrahydronaphthalen-1-yl] (2E,4E,6E)-deca-2,4,6-trienoate.
| Compound Name | [(1R,4R,4aS,6Z)-4-hydroxy-6-(1-methoxy-1-oxopropan-2-ylidene)-4,4a-dimethyl-7-oxo-1,2,3,5-tetrahydronaphthalen-1-yl] (2E,4E,6E)-deca-2,4,6-trienoate |
|---|---|
| PubChem CID | 170989747 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | [(1R,4R,4aS,6Z)-4-hydroxy-6-(1-methoxy-1-oxopropan-2-ylidene)-4,4a-dimethyl-7-oxo-1,2,3,5-tetrahydronaphthalen-1-yl] (2E,4E,6E)-deca-2,4,6-trienoate |
| SMILES | CCC/C=C/C=C/C=C/C(=O)O[C@@H]1CC[C@@](C)(O)[C@@]2(C)C/C(=C(\C)C(=O)OC)C(=O)C=C12 |
| InChI | InChI=1S/C26H34O6/c1-6-7-8-9-10-11-12-13-23(28)32-22-14-15-26(4,30)25(3)17-19(18(2)24(29)31-5)21(27)16-20(22)25/h8-13,16,22,30H,6-7,14-15,17H2,1-5H3/b9-8+,11-10+,13-12+,19-18-/t22-,25+,26-/m1/s1 |
| InChIKey | SVCLXCHVGLSWDJ-GEJLNOHESA-N |
| XLogP | 4.31 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|