C26H34O7 — CID 170989753
3-[(1R,2S,6S,7S,9R,11S)-11-hydroxy-1-methoxycarbonyl-2,6,9,11-tetramethyl-13-methylidene-10,12-dioxo-5-propan-2-ylidene-6-tricyclo[7.3.1.02,7]tridec-3-enyl]propanoic acid (PubChem CID 170989753) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is 3-[(1R,2S,6S,7S,9R,11S)-11-hydroxy-1-methoxycarbonyl-2,6,9,11-tetramethyl-13-methylidene-10,12-dioxo-5-propan-2-ylidene-6-tricyclo[7.3.1.02,7]tridec-3-enyl]propanoic acid.
| Compound Name | 3-[(1R,2S,6S,7S,9R,11S)-11-hydroxy-1-methoxycarbonyl-2,6,9,11-tetramethyl-13-methylidene-10,12-dioxo-5-propan-2-ylidene-6-tricyclo[7.3.1.02,7]tridec-3-enyl]propanoic acid |
|---|---|
| PubChem CID | 170989753 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 3-[(1R,2S,6S,7S,9R,11S)-11-hydroxy-1-methoxycarbonyl-2,6,9,11-tetramethyl-13-methylidene-10,12-dioxo-5-propan-2-ylidene-6-tricyclo[7.3.1.02,7]tridec-3-enyl]propanoic acid |
| SMILES | C=C1[C@@]2(C)C[C@@H]3[C@](C)(C=CC(=C(C)C)[C@@]3(C)CCC(=O)O)[C@]1(C(=O)OC)C(=O)[C@@](C)(O)C2=O |
| InChI | InChI=1S/C26H34O7/c1-14(2)16-9-12-24(6)17(22(16,4)11-10-18(27)28)13-23(5)15(3)26(24,21(31)33-8)20(30)25(7,32)19(23)29/h9,12,17,32H,3,10-11,13H2,1-2,4-8H3,(H,27,28)/t17-,22+,23+,24-,25-,26-/m0/s1 |
| InChIKey | OXAPBGPMLBMPSU-QFRJCEMRSA-N |
| XLogP | 3.41 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|