C19H26O5 — CID 170989755
[(1S,4S,5S,6R)-4,5-dihydroxy-6-methoxy-3-(7-methyl-3-methylideneoct-6-en-1-ynyl)cyclohex-2-en-1-yl] acetate (PubChem CID 170989755) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is [(1S,4S,5S,6R)-4,5-dihydroxy-6-methoxy-3-(7-methyl-3-methylideneoct-6-en-1-ynyl)cyclohex-2-en-1-yl] acetate.
| Compound Name | [(1S,4S,5S,6R)-4,5-dihydroxy-6-methoxy-3-(7-methyl-3-methylideneoct-6-en-1-ynyl)cyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 170989755 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [(1S,4S,5S,6R)-4,5-dihydroxy-6-methoxy-3-(7-methyl-3-methylideneoct-6-en-1-ynyl)cyclohex-2-en-1-yl] acetate |
| SMILES | C=C(C#CC1=C[C@H](OC(C)=O)[C@H](OC)[C@@H](O)[C@H]1O)CCC=C(C)C |
| InChI | InChI=1S/C19H26O5/c1-12(2)7-6-8-13(3)9-10-15-11-16(24-14(4)20)19(23-5)18(22)17(15)21/h7,11,16-19,21-22H,3,6,8H2,1-2,4-5H3/t16-,17-,18-,19-/m0/s1 |
| InChIKey | KERSBOSZPDIVEV-VJANTYMQSA-N |
| XLogP | 1.90 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|