C19H26O6 — CID 170989757
[(1S,4S,5S,6R)-4,5-dihydroxy-3-(7-hydroxy-7-methyl-3-methylideneoct-5-en-1-ynyl)-6-methoxycyclohex-2-en-1-yl] acetate (PubChem CID 170989757) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is [(1S,4S,5S,6R)-4,5-dihydroxy-3-(7-hydroxy-7-methyl-3-methylideneoct-5-en-1-ynyl)-6-methoxycyclohex-2-en-1-yl] acetate.
| Compound Name | [(1S,4S,5S,6R)-4,5-dihydroxy-3-(7-hydroxy-7-methyl-3-methylideneoct-5-en-1-ynyl)-6-methoxycyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 170989757 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [(1S,4S,5S,6R)-4,5-dihydroxy-3-(7-hydroxy-7-methyl-3-methylideneoct-5-en-1-ynyl)-6-methoxycyclohex-2-en-1-yl] acetate |
| SMILES | C=C(C#CC1=C[C@H](OC(C)=O)[C@H](OC)[C@@H](O)[C@H]1O)CC=CC(C)(C)O |
| InChI | InChI=1S/C19H26O6/c1-12(7-6-10-19(3,4)23)8-9-14-11-15(25-13(2)20)18(24-5)17(22)16(14)21/h6,10-11,15-18,21-23H,1,7H2,2-5H3/t15-,16-,17-,18-/m0/s1 |
| InChIKey | PMTIHTVDYXCLLH-XSLAGTTESA-N |
| XLogP | 0.87 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|