C19H26O6 — CID 170989759
[(1S,4S,5S,6R)-4,5-dihydroxy-3-(6-hydroxy-7-methyl-3-methylideneoct-7-en-1-ynyl)-6-methoxycyclohex-2-en-1-yl] acetate (PubChem CID 170989759) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is [(1S,4S,5S,6R)-4,5-dihydroxy-3-(6-hydroxy-7-methyl-3-methylideneoct-7-en-1-ynyl)-6-methoxycyclohex-2-en-1-yl] acetate.
| Compound Name | [(1S,4S,5S,6R)-4,5-dihydroxy-3-(6-hydroxy-7-methyl-3-methylideneoct-7-en-1-ynyl)-6-methoxycyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 170989759 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [(1S,4S,5S,6R)-4,5-dihydroxy-3-(6-hydroxy-7-methyl-3-methylideneoct-7-en-1-ynyl)-6-methoxycyclohex-2-en-1-yl] acetate |
| SMILES | C=C(C#CC1=C[C@H](OC(C)=O)[C@H](OC)[C@@H](O)[C@H]1O)CCC(O)C(=C)C |
| InChI | InChI=1S/C19H26O6/c1-11(2)15(21)9-7-12(3)6-8-14-10-16(25-13(4)20)19(24-5)18(23)17(14)22/h10,15-19,21-23H,1,3,7,9H2,2,4-5H3/t15?,16-,17-,18-,19-/m0/s1 |
| InChIKey | ZBTKVOXQUHLONV-WNBKYALVSA-N |
| XLogP | 0.87 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|