C15H24O2 — CID 170989784
(3S,4aR,9aS)-3-hydroxy-2,2,4a,7-tetramethyl-3,4,5,8,9,9a-hexahydrobenzo[7]annulen-1-one (PubChem CID 170989784) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (3S,4aR,9aS)-3-hydroxy-2,2,4a,7-tetramethyl-3,4,5,8,9,9a-hexahydrobenzo[7]annulen-1-one.
| Compound Name | (3S,4aR,9aS)-3-hydroxy-2,2,4a,7-tetramethyl-3,4,5,8,9,9a-hexahydrobenzo[7]annulen-1-one |
|---|---|
| PubChem CID | 170989784 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (3S,4aR,9aS)-3-hydroxy-2,2,4a,7-tetramethyl-3,4,5,8,9,9a-hexahydrobenzo[7]annulen-1-one |
| SMILES | CC1=CC[C@]2(C)C[C@H](O)C(C)(C)C(=O)[C@H]2CC1 |
| InChI | InChI=1S/C15H24O2/c1-10-5-6-11-13(17)14(2,3)12(16)9-15(11,4)8-7-10/h7,11-12,16H,5-6,8-9H2,1-4H3/t11-,12+,15-/m1/s1 |
| InChIKey | HQZLDVUXBYKLHL-TYNCELHUSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|