C15H26O4 — CID 170989788
(1R,2R,3S,3aS,8aS)-6-(hydroxymethyl)-8a-methyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulene-1,2,3-triol (PubChem CID 170989788) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1R,2R,3S,3aS,8aS)-6-(hydroxymethyl)-8a-methyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulene-1,2,3-triol.
| Compound Name | (1R,2R,3S,3aS,8aS)-6-(hydroxymethyl)-8a-methyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulene-1,2,3-triol |
|---|---|
| PubChem CID | 170989788 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (1R,2R,3S,3aS,8aS)-6-(hydroxymethyl)-8a-methyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulene-1,2,3-triol |
| SMILES | CC(C)[C@@]1(O)[C@H](O)[C@H](O)[C@@]2(C)CC=C(CO)CC[C@@H]21 |
| InChI | InChI=1S/C15H26O4/c1-9(2)15(19)11-5-4-10(8-16)6-7-14(11,3)12(17)13(15)18/h6,9,11-13,16-19H,4-5,7-8H2,1-3H3/t11-,12-,13+,14-,15-/m0/s1 |
| InChIKey | BYYQMGWZFXSROF-RMEBNNNOSA-N |
| XLogP | 0.83 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|