C27H38O4 — CID 170989799
[(6R)-6-[(1S,3S,7R,9E,13R,15S,16R)-3,15-dimethyl-11-oxo-12-oxatetracyclo[8.5.1.03,7.013,16]hexadeca-5,9-dien-6-yl]-2-methylhept-2-enyl] acetate (PubChem CID 170989799) has the molecular formula C27H38O4 and a molecular weight of 426.60 g/mol. Its IUPAC name is [(6R)-6-[(1S,3S,7R,9E,13R,15S,16R)-3,15-dimethyl-11-oxo-12-oxatetracyclo[8.5.1.03,7.013,16]hexadeca-5,9-dien-6-yl]-2-methylhept-2-enyl] acetate.
| Compound Name | [(6R)-6-[(1S,3S,7R,9E,13R,15S,16R)-3,15-dimethyl-11-oxo-12-oxatetracyclo[8.5.1.03,7.013,16]hexadeca-5,9-dien-6-yl]-2-methylhept-2-enyl] acetate |
|---|---|
| PubChem CID | 170989799 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | [(6R)-6-[(1S,3S,7R,9E,13R,15S,16R)-3,15-dimethyl-11-oxo-12-oxatetracyclo[8.5.1.03,7.013,16]hexadeca-5,9-dien-6-yl]-2-methylhept-2-enyl] acetate |
| SMILES | CC(=O)OCC(C)=CCC[C@@H](C)C1=CC[C@]2(C)C[C@@H]3[C@@H]4/C(=C\C[C@@H]12)C(=O)O[C@@H]4C[C@@H]3C |
| InChI | InChI=1S/C27H38O4/c1-16(15-30-19(4)28)7-6-8-17(2)20-11-12-27(5)14-22-18(3)13-24-25(22)21(26(29)31-24)9-10-23(20)27/h7,9,11,17-18,22-25H,6,8,10,12-15H2,1-5H3/b16-7?,21-9+/t17-,18+,22+,23+,24-,25+,27-/m1/s1 |
| InChIKey | WCVGJQNTSQQMGT-LILPOMBYSA-N |
| XLogP | 5.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|