C17H18O5 — CID 170989882
(3S)-7,9-dimethoxy-3,6-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione (PubChem CID 170989882) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is (3S)-7,9-dimethoxy-3,6-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione.
| Compound Name | (3S)-7,9-dimethoxy-3,6-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
|---|---|
| PubChem CID | 170989882 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (3S)-7,9-dimethoxy-3,6-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
| SMILES | COc1cc(OC)c2c(c1C)C(=O)C1=C(CO[C@@H](C)C1)C2=O |
| InChI | InChI=1S/C17H18O5/c1-8-5-10-11(7-22-8)17(19)15-13(21-4)6-12(20-3)9(2)14(15)16(10)18/h6,8H,5,7H2,1-4H3/t8-/m0/s1 |
| InChIKey | MFVJRKPCNNWJQZ-QMMMGPOBSA-N |
| XLogP | 2.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|