C18H30O5 — CID 170989950
(2R,4R,6R)-6-(8,12-dihydroxytrideca-2,4,6-trienyl)oxane-2,4-diol (PubChem CID 170989950) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is (2R,4R,6R)-6-(8,12-dihydroxytrideca-2,4,6-trienyl)oxane-2,4-diol.
| Compound Name | (2R,4R,6R)-6-(8,12-dihydroxytrideca-2,4,6-trienyl)oxane-2,4-diol |
|---|---|
| PubChem CID | 170989950 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (2R,4R,6R)-6-(8,12-dihydroxytrideca-2,4,6-trienyl)oxane-2,4-diol |
| SMILES | CC(O)CCCC(O)C=CC=CC=CC[C@@H]1C[C@@H](O)C[C@H](O)O1 |
| InChI | InChI=1S/C18H30O5/c1-14(19)8-7-10-15(20)9-5-3-2-4-6-11-17-12-16(21)13-18(22)23-17/h2-6,9,14-22H,7-8,10-13H2,1H3/t14?,15?,16-,17-,18-/m1/s1 |
| InChIKey | NSTVAYQLVIAGAV-NHHFINERSA-N |
| XLogP | 1.82 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|