C18H30O3 — CID 170989956
2-[(3E,5E,7E)-2-hydroxytrideca-3,5,7-trienyl]oxan-4-ol (PubChem CID 170989956) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-[(3E,5E,7E)-2-hydroxytrideca-3,5,7-trienyl]oxan-4-ol.
| Compound Name | 2-[(3E,5E,7E)-2-hydroxytrideca-3,5,7-trienyl]oxan-4-ol |
|---|---|
| PubChem CID | 170989956 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 2-[(3E,5E,7E)-2-hydroxytrideca-3,5,7-trienyl]oxan-4-ol |
| SMILES | CCCCC/C=C/C=C/C=C/C(O)CC1CC(O)CCO1 |
| InChI | InChI=1S/C18H30O3/c1-2-3-4-5-6-7-8-9-10-11-16(19)14-18-15-17(20)12-13-21-18/h6-11,16-20H,2-5,12-15H2,1H3/b7-6+,9-8+,11-10+ |
| InChIKey | SQSCMSMRKZAJIQ-OBWVEWQSSA-N |
| XLogP | 3.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|