C27H34O7 — CID 170989972
(1R,2S,3S,5S,7R,10R)-3,5,7-trihydroxy-14-(4-methoxyphenyl)-2,6,6,10-tetramethyl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-16-one (PubChem CID 170989972) has the molecular formula C27H34O7 and a molecular weight of 470.56 g/mol. Its IUPAC name is (1R,2S,3S,5S,7R,10R)-3,5,7-trihydroxy-14-(4-methoxyphenyl)-2,6,6,10-tetramethyl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-16-one.
| Compound Name | (1R,2S,3S,5S,7R,10R)-3,5,7-trihydroxy-14-(4-methoxyphenyl)-2,6,6,10-tetramethyl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-16-one |
|---|---|
| PubChem CID | 170989972 |
| Molecular Formula | C27H34O7 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | (1R,2S,3S,5S,7R,10R)-3,5,7-trihydroxy-14-(4-methoxyphenyl)-2,6,6,10-tetramethyl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-16-one |
| SMILES | COc1ccc(-c2cc3c(c(=O)o2)C[C@@H]2[C@@]4(C)[C@@H](O)C[C@H](O)C(C)(C)[C@]4(O)CC[C@@]2(C)O3)cc1 |
| InChI | InChI=1S/C27H34O7/c1-24(2)21(28)14-22(29)26(4)20-12-17-19(34-25(20,3)10-11-27(24,26)31)13-18(33-23(17)30)15-6-8-16(32-5)9-7-15/h6-9,13,20-22,28-29,31H,10-12,14H2,1-5H3/t20-,21-,22-,25+,26-,27+/m0/s1 |
| InChIKey | ISWGEPLGYBTQEQ-HGRMQABVSA-N |
| XLogP | 3.31 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |