C25H29ClO6 — CID 170989986
(3R,6S)-3-[(7S,8S)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-7-hydroxy-7-methyl-6-oxo-8H-isochromen-8-yl]-6-methyloxane-2,4-dione (PubChem CID 170989986) has the molecular formula C25H29ClO6 and a molecular weight of 460.95 g/mol. Its IUPAC name is (3R,6S)-3-[(7S,8S)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-7-hydroxy-7-methyl-6-oxo-8H-isochromen-8-yl]-6-methyloxane-2,4-dione.
| Compound Name | (3R,6S)-3-[(7S,8S)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-7-hydroxy-7-methyl-6-oxo-8H-isochromen-8-yl]-6-methyloxane-2,4-dione |
|---|---|
| PubChem CID | 170989986 |
| Molecular Formula | C25H29ClO6 |
| Molecular Weight | 460.95 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (3R,6S)-3-[(7S,8S)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-7-hydroxy-7-methyl-6-oxo-8H-isochromen-8-yl]-6-methyloxane-2,4-dione |
| SMILES | CC[C@H](C)/C=C(C)/C=C/C1=CC2=C(Cl)C(=O)[C@@](C)(O)[C@@H]([C@@H]3C(=O)C[C@H](C)OC3=O)C2=CO1 |
| InChI | InChI=1S/C25H29ClO6/c1-6-13(2)9-14(3)7-8-16-11-17-18(12-31-16)21(25(5,30)23(28)22(17)26)20-19(27)10-15(4)32-24(20)29/h7-9,11-13,15,20-21,30H,6,10H2,1-5H3/b8-7+,14-9+/t13-,15-,20-,21+,25-/m0/s1 |
| InChIKey | WIVQOJAPCBUNIS-NJOPQSEHSA-N |
| XLogP | 4.30 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.95 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|