C17H24O5 — CID 170990010
(1R,5S,8S,10R)-10-hydroxy-3-methyl-1-(2-oxobutyl)-8-propyl-7-oxaspiro[4.5]dec-2-ene-4,6-dione (PubChem CID 170990010) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is (1R,5S,8S,10R)-10-hydroxy-3-methyl-1-(2-oxobutyl)-8-propyl-7-oxaspiro[4.5]dec-2-ene-4,6-dione.
| Compound Name | (1R,5S,8S,10R)-10-hydroxy-3-methyl-1-(2-oxobutyl)-8-propyl-7-oxaspiro[4.5]dec-2-ene-4,6-dione |
|---|---|
| PubChem CID | 170990010 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (1R,5S,8S,10R)-10-hydroxy-3-methyl-1-(2-oxobutyl)-8-propyl-7-oxaspiro[4.5]dec-2-ene-4,6-dione |
| SMILES | CCC[C@H]1C[C@@H](O)[C@]2(C(=O)O1)C(=O)C(C)=C[C@H]2CC(=O)CC |
| InChI | InChI=1S/C17H24O5/c1-4-6-13-9-14(19)17(16(21)22-13)11(8-12(18)5-2)7-10(3)15(17)20/h7,11,13-14,19H,4-6,8-9H2,1-3H3/t11-,13-,14+,17-/m0/s1 |
| InChIKey | CUSCWFDAXNZPPA-DPYKFYPSSA-N |
| XLogP | 1.96 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|